C18H24IN5OS — CID 111281510
3-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-1-[(2-methoxyphenyl)methyl]-1-methylguanidine;hydroiodide (PubChem CID 111281510) has the molecular formula C18H24IN5OS and a molecular weight of 485.40 g/mol. Its IUPAC name is 3-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-1-[(2-methoxyphenyl)methyl]-1-methylguanidine;hydroiodide.
| Compound Name | 3-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-1-[(2-methoxyphenyl)methyl]-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111281510 |
| Molecular Formula | C18H24IN5OS |
| Molecular Weight | 485.40 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | 3-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-1-[(2-methoxyphenyl)methyl]-1-methylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cn2ccsc2n1)N(C)Cc1ccccc1OC.I |
| InChI | InChI=1S/C18H23N5OS.HI/c1-4-19-17(20-11-15-13-23-9-10-25-18(23)21-15)22(2)12-14-7-5-6-8-16(14)24-3;/h5-10,13H,4,11-12H2,1-3H3,(H,19,20);1H |
| InChIKey | JEYVNGWGGSOEJT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 54.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|