C15H23N5OS — CID 109386305
3-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-1-methyl-1-(oxolan-3-ylmethyl)guanidine (PubChem CID 109386305) has the molecular formula C15H23N5OS and a molecular weight of 321.45 g/mol. Its IUPAC name is 3-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-1-methyl-1-(oxolan-3-ylmethyl)guanidine.
| Compound Name | 3-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-1-methyl-1-(oxolan-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 109386305 |
| Molecular Formula | C15H23N5OS |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 3-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-1-methyl-1-(oxolan-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1cn2ccsc2n1)N(C)CC1CCOC1 |
| InChI | InChI=1S/C15H23N5OS/c1-3-16-14(19(2)9-12-4-6-21-11-12)17-8-13-10-20-5-7-22-15(20)18-13/h5,7,10,12H,3-4,6,8-9,11H2,1-2H3,(H,16,17) |
| InChIKey | MAUIHCOMUTWXCR-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 54.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|