C18H30IN5O2S — CID 111642623
1-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-3-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide (PubChem CID 111642623) has the molecular formula C18H30IN5O2S and a molecular weight of 507.44 g/mol. Its IUPAC name is 1-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-3-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-3-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111642623 |
| Molecular Formula | C18H30IN5O2S |
| Molecular Weight | 507.44 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | 1-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-3-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cn2ccsc2n1)NCCCOCC1CCOCC1.I |
| InChI | InChI=1S/C18H29N5O2S.HI/c1-2-19-17(21-12-16-13-23-7-11-26-18(23)22-16)20-6-3-8-25-14-15-4-9-24-10-5-15;/h7,11,13,15H,2-6,8-10,12,14H2,1H3,(H2,19,20,21);1H |
| InChIKey | MSWDTTYMQBRXTF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|