C16H29IN6OS — CID 111651099
1-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-3-[2-[3-methoxypropyl(methyl)amino]ethyl]guanidine;hydroiodide (PubChem CID 111651099) has the molecular formula C16H29IN6OS and a molecular weight of 480.42 g/mol. Its IUPAC name is 1-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-3-[2-[3-methoxypropyl(methyl)amino]ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-3-[2-[3-methoxypropyl(methyl)amino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111651099 |
| Molecular Formula | C16H29IN6OS |
| Molecular Weight | 480.42 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | 1-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-3-[2-[3-methoxypropyl(methyl)amino]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cn2ccsc2n1)NCCN(C)CCCOC.I |
| InChI | InChI=1S/C16H28N6OS.HI/c1-4-17-15(18-6-8-21(2)7-5-10-23-3)19-12-14-13-22-9-11-24-16(22)20-14;/h9,11,13H,4-8,10,12H2,1-3H3,(H2,17,18,19);1H |
| InChIKey | DZVAFBZEXGMOAX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 66.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|