C17H24N6OS2 — CID 109456850
3-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine (PubChem CID 109456850) has the molecular formula C17H24N6OS2 and a molecular weight of 392.55 g/mol. Its IUPAC name is 3-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine.
| Compound Name | 3-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine |
|---|---|
| PubChem CID | 109456850 |
| Molecular Formula | C17H24N6OS2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 3-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine |
| SMILES | CCN/C(=N\Cc1cn2ccsc2n1)N(C)Cc1csc(C(C)OC)n1 |
| InChI | InChI=1S/C17H24N6OS2/c1-5-18-16(19-8-13-10-23-6-7-25-17(23)21-13)22(3)9-14-11-26-15(20-14)12(2)24-4/h6-7,10-12H,5,8-9H2,1-4H3,(H,18,19) |
| InChIKey | DJEZYTSTSHXGQT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|