C16H30N4O2S — CID 109454704
3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-2-(2-methoxy-2-methylpropyl)-1-methylguanidine (PubChem CID 109454704) has the molecular formula C16H30N4O2S and a molecular weight of 342.51 g/mol. Its IUPAC name is 3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-2-(2-methoxy-2-methylpropyl)-1-methylguanidine.
| Compound Name | 3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-2-(2-methoxy-2-methylpropyl)-1-methylguanidine |
|---|---|
| PubChem CID | 109454704 |
| Molecular Formula | C16H30N4O2S |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-2-(2-methoxy-2-methylpropyl)-1-methylguanidine |
| SMILES | CCN/C(=N\CC(C)(C)OC)N(C)Cc1csc(C(C)OC)n1 |
| InChI | InChI=1S/C16H30N4O2S/c1-8-17-15(18-11-16(3,4)22-7)20(5)9-13-10-23-14(19-13)12(2)21-6/h10,12H,8-9,11H2,1-7H3,(H,17,18) |
| InChIKey | PDHFIWFEUWCMQV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 58.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|