C18H29IN4OS2 — CID 109455497
3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-2-(2-thiophen-2-ylpropyl)guanidine;hydroiodide (PubChem CID 109455497) has the molecular formula C18H29IN4OS2 and a molecular weight of 508.50 g/mol. Its IUPAC name is 3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-2-(2-thiophen-2-ylpropyl)guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-2-(2-thiophen-2-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109455497 |
| Molecular Formula | C18H29IN4OS2 |
| Molecular Weight | 508.50 g/mol |
| Exact Mass | 508.08 |
| IUPAC Name | 3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-2-(2-thiophen-2-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)c1cccs1)N(C)Cc1csc(C(C)OC)n1.I |
| InChI | InChI=1S/C18H28N4OS2.HI/c1-6-19-18(20-10-13(2)16-8-7-9-24-16)22(4)11-15-12-25-17(21-15)14(3)23-5;/h7-9,12-14H,6,10-11H2,1-5H3,(H,19,20);1H |
| InChIKey | JLRVQSMFWPRLTM-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|