C19H27ClN4O2S — CID 109456196
2-[2-(2-chlorophenyl)-2-hydroxyethyl]-3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine (PubChem CID 109456196) has the molecular formula C19H27ClN4O2S and a molecular weight of 410.97 g/mol. Its IUPAC name is 2-[2-(2-chlorophenyl)-2-hydroxyethyl]-3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine.
| Compound Name | 2-[2-(2-chlorophenyl)-2-hydroxyethyl]-3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine |
|---|---|
| PubChem CID | 109456196 |
| Molecular Formula | C19H27ClN4O2S |
| Molecular Weight | 410.97 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 2-[2-(2-chlorophenyl)-2-hydroxyethyl]-3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine |
| SMILES | CCN/C(=N\CC(O)c1ccccc1Cl)N(C)Cc1csc(C(C)OC)n1 |
| InChI | InChI=1S/C19H27ClN4O2S/c1-5-21-19(22-10-17(25)15-8-6-7-9-16(15)20)24(3)11-14-12-27-18(23-14)13(2)26-4/h6-9,12-13,17,25H,5,10-11H2,1-4H3,(H,21,22) |
| InChIKey | UBWAZXMJJSCPEB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 69.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.97 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|