C18H26ClN5O2S — CID 109454700
2-[2-[(3-chloro-2-pyridinyl)oxy]ethyl]-3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine (PubChem CID 109454700) has the molecular formula C18H26ClN5O2S and a molecular weight of 411.96 g/mol. Its IUPAC name is 2-[2-[(3-chloro-2-pyridinyl)oxy]ethyl]-3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine.
| Compound Name | 2-[2-[(3-chloro-2-pyridinyl)oxy]ethyl]-3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine |
|---|---|
| PubChem CID | 109454700 |
| Molecular Formula | C18H26ClN5O2S |
| Molecular Weight | 411.96 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 2-[2-[(3-chloro-2-pyridinyl)oxy]ethyl]-3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine |
| SMILES | CCN/C(=N\CCOc1ncccc1Cl)N(C)Cc1csc(C(C)OC)n1 |
| InChI | InChI=1S/C18H26ClN5O2S/c1-5-20-18(22-9-10-26-16-15(19)7-6-8-21-16)24(3)11-14-12-27-17(23-14)13(2)25-4/h6-8,12-13H,5,9-11H2,1-4H3,(H,20,22) |
| InChIKey | DWDLFMRMUPCNFI-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.96 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|