C17H27N5OS3 — CID 109455842
3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-2-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine (PubChem CID 109455842) has the molecular formula C17H27N5OS3 and a molecular weight of 413.64 g/mol. Its IUPAC name is 3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-2-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine.
| Compound Name | 3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-2-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine |
|---|---|
| PubChem CID | 109455842 |
| Molecular Formula | C17H27N5OS3 |
| Molecular Weight | 413.64 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-2-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine |
| SMILES | CCN/C(=N\CCCSc1nccs1)N(C)Cc1csc(C(C)OC)n1 |
| InChI | InChI=1S/C17H27N5OS3/c1-5-18-16(19-7-6-9-24-17-20-8-10-25-17)22(3)11-14-12-26-15(21-14)13(2)23-4/h8,10,12-13H,5-7,9,11H2,1-4H3,(H,18,19) |
| InChIKey | YHNYHAMSMCPMAR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.64 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|