C18H34IN5O2S — CID 109456881
3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-2-(3-morpholin-4-ylpropyl)guanidine;hydroiodide (PubChem CID 109456881) has the molecular formula C18H34IN5O2S and a molecular weight of 511.47 g/mol. Its IUPAC name is 3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-2-(3-morpholin-4-ylpropyl)guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-2-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109456881 |
| Molecular Formula | C18H34IN5O2S |
| Molecular Weight | 511.47 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | 3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-2-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCN1CCOCC1)N(C)Cc1csc(C(C)OC)n1.I |
| InChI | InChI=1S/C18H33N5O2S.HI/c1-5-19-18(20-7-6-8-23-9-11-25-12-10-23)22(3)13-16-14-26-17(21-16)15(2)24-4;/h14-15H,5-13H2,1-4H3,(H,19,20);1H |
| InChIKey | QEUPFLOJTWYNAT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.47 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|