C19H36IN5O2S — CID 109456025
1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-(3-methyl-2-morpholin-4-ylbutyl)guanidine;hydroiodide (PubChem CID 109456025) has the molecular formula C19H36IN5O2S and a molecular weight of 525.50 g/mol. Its IUPAC name is 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-(3-methyl-2-morpholin-4-ylbutyl)guanidine;hydroiodide.
| Compound Name | 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-(3-methyl-2-morpholin-4-ylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109456025 |
| Molecular Formula | C19H36IN5O2S |
| Molecular Weight | 525.50 g/mol |
| Exact Mass | 525.16 |
| IUPAC Name | 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-(3-methyl-2-morpholin-4-ylbutyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCC(C(C)C)N1CCOCC1)N(C)Cc1csc(C(C)OC)n1.I |
| InChI | InChI=1S/C19H35N5O2S.HI/c1-14(2)17(24-7-9-26-10-8-24)11-21-19(20-4)23(5)12-16-13-27-18(22-16)15(3)25-6;/h13-15,17H,7-12H2,1-6H3,(H,20,21);1H |
| InChIKey | YTQYEMXSURUDHW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.50 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|