C18H33N5O2S — CID 109454888
1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[2-(3-methylmorpholin-4-yl)propyl]guanidine (PubChem CID 109454888) has the molecular formula C18H33N5O2S and a molecular weight of 383.56 g/mol. Its IUPAC name is 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[2-(3-methylmorpholin-4-yl)propyl]guanidine.
| Compound Name | 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[2-(3-methylmorpholin-4-yl)propyl]guanidine |
|---|---|
| PubChem CID | 109454888 |
| Molecular Formula | C18H33N5O2S |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[2-(3-methylmorpholin-4-yl)propyl]guanidine |
| SMILES | C/N=C(/NCC(C)N1CCOCC1C)N(C)Cc1csc(C(C)OC)n1 |
| InChI | InChI=1S/C18H33N5O2S/c1-13(23-7-8-25-11-14(23)2)9-20-18(19-4)22(5)10-16-12-26-17(21-16)15(3)24-6/h12-15H,7-11H2,1-6H3,(H,19,20) |
| InChIKey | KJARATDSIPFOBV-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|