C24H37N5OS — CID 109456376
1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[[2-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]guanidine (PubChem CID 109456376) has the molecular formula C24H37N5OS and a molecular weight of 443.66 g/mol. Its IUPAC name is 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[[2-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]guanidine.
| Compound Name | 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[[2-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 109456376 |
| Molecular Formula | C24H37N5OS |
| Molecular Weight | 443.66 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[[2-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]guanidine |
| SMILES | C/N=C(/NCc1ccccc1CN1CCC(C)CC1)N(C)Cc1csc(C(C)OC)n1 |
| InChI | InChI=1S/C24H37N5OS/c1-18-10-12-29(13-11-18)15-21-9-7-6-8-20(21)14-26-24(25-3)28(4)16-22-17-31-23(27-22)19(2)30-5/h6-9,17-19H,10-16H2,1-5H3,(H,25,26) |
| InChIKey | OAPWUSUPKSXIFA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.66 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|