C19H33F3IN5OS — CID 109454879
1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine;hydroiodide (PubChem CID 109454879) has the molecular formula C19H33F3IN5OS and a molecular weight of 563.47 g/mol. Its IUPAC name is 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine;hydroiodide.
| Compound Name | 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109454879 |
| Molecular Formula | C19H33F3IN5OS |
| Molecular Weight | 563.47 g/mol |
| Exact Mass | 563.14 |
| IUPAC Name | 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCC1CCN(CC(F)(F)F)CC1)N(C)Cc1csc(C(C)OC)n1.I |
| InChI | InChI=1S/C19H32F3N5OS.HI/c1-14(28-4)17-25-16(12-29-17)11-26(3)18(23-2)24-8-5-15-6-9-27(10-7-15)13-19(20,21)22;/h12,14-15H,5-11,13H2,1-4H3,(H,23,24);1H |
| InChIKey | PEWDTJLTJYVVCZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|