C17H33IN4OS — CID 109456671
3-(4,4-dimethylpentyl)-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 109456671) has the molecular formula C17H33IN4OS and a molecular weight of 468.45 g/mol. Its IUPAC name is 3-(4,4-dimethylpentyl)-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 3-(4,4-dimethylpentyl)-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109456671 |
| Molecular Formula | C17H33IN4OS |
| Molecular Weight | 468.45 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 3-(4,4-dimethylpentyl)-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCC(C)(C)C)N(C)Cc1csc(C(C)OC)n1.I |
| InChI | InChI=1S/C17H32N4OS.HI/c1-13(22-7)15-20-14(12-23-15)11-21(6)16(18-5)19-10-8-9-17(2,3)4;/h12-13H,8-11H2,1-7H3,(H,18,19);1H |
| InChIKey | XOMUQXYUMCMFDO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|