C15H28N4O2S — CID 109455400
3-(3-ethoxypropyl)-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine (PubChem CID 109455400) has the molecular formula C15H28N4O2S and a molecular weight of 328.48 g/mol. Its IUPAC name is 3-(3-ethoxypropyl)-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine.
| Compound Name | 3-(3-ethoxypropyl)-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 109455400 |
| Molecular Formula | C15H28N4O2S |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 3-(3-ethoxypropyl)-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine |
| SMILES | CCOCCCN/C(=N\C)N(C)Cc1csc(C(C)OC)n1 |
| InChI | InChI=1S/C15H28N4O2S/c1-6-21-9-7-8-17-15(16-3)19(4)10-13-11-22-14(18-13)12(2)20-5/h11-12H,6-10H2,1-5H3,(H,16,17) |
| InChIKey | OQYQXEZKDAHXNN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 58.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|