C20H36N4O2S — CID 109456320
3-[[1-(2-ethoxyethyl)cyclopentyl]methyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine (PubChem CID 109456320) has the molecular formula C20H36N4O2S and a molecular weight of 396.60 g/mol. Its IUPAC name is 3-[[1-(2-ethoxyethyl)cyclopentyl]methyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine.
| Compound Name | 3-[[1-(2-ethoxyethyl)cyclopentyl]methyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 109456320 |
| Molecular Formula | C20H36N4O2S |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | 3-[[1-(2-ethoxyethyl)cyclopentyl]methyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine |
| SMILES | CCOCCC1(CN/C(=N/C)N(C)Cc2csc(C(C)OC)n2)CCCC1 |
| InChI | InChI=1S/C20H36N4O2S/c1-6-26-12-11-20(9-7-8-10-20)15-22-19(21-3)24(4)13-17-14-27-18(23-17)16(2)25-5/h14,16H,6-13,15H2,1-5H3,(H,21,22) |
| InChIKey | GEUQCOSZGWWLDU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 58.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|