C22H33IN4OS — CID 109454977
1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[(1-phenylcyclopentyl)methyl]guanidine;hydroiodide (PubChem CID 109454977) has the molecular formula C22H33IN4OS and a molecular weight of 528.50 g/mol. Its IUPAC name is 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[(1-phenylcyclopentyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[(1-phenylcyclopentyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109454977 |
| Molecular Formula | C22H33IN4OS |
| Molecular Weight | 528.50 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[(1-phenylcyclopentyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCC1(c2ccccc2)CCCC1)N(C)Cc1csc(C(C)OC)n1.I |
| InChI | InChI=1S/C22H32N4OS.HI/c1-17(27-4)20-25-19(15-28-20)14-26(3)21(23-2)24-16-22(12-8-9-13-22)18-10-6-5-7-11-18;/h5-7,10-11,15,17H,8-9,12-14,16H2,1-4H3,(H,23,24);1H |
| InChIKey | MECGJNOEIUPJPZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.50 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|