C23H34N4O2S — CID 109456858
3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-2-[(4-phenyloxan-4-yl)methyl]guanidine (PubChem CID 109456858) has the molecular formula C23H34N4O2S and a molecular weight of 430.62 g/mol. Its IUPAC name is 3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-2-[(4-phenyloxan-4-yl)methyl]guanidine.
| Compound Name | 3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-2-[(4-phenyloxan-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109456858 |
| Molecular Formula | C23H34N4O2S |
| Molecular Weight | 430.62 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-2-[(4-phenyloxan-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\CC1(c2ccccc2)CCOCC1)N(C)Cc1csc(C(C)OC)n1 |
| InChI | InChI=1S/C23H34N4O2S/c1-5-24-22(27(3)15-20-16-30-21(26-20)18(2)28-4)25-17-23(11-13-29-14-12-23)19-9-7-6-8-10-19/h6-10,16,18H,5,11-15,17H2,1-4H3,(H,24,25) |
| InChIKey | MMULSVVDQCFZIG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 58.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.62 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|