C21H29ClN4OS — CID 109457096
2-[[1-(3-chlorophenyl)cyclopropyl]methyl]-3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine (PubChem CID 109457096) has the molecular formula C21H29ClN4OS and a molecular weight of 421.01 g/mol. Its IUPAC name is 2-[[1-(3-chlorophenyl)cyclopropyl]methyl]-3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine.
| Compound Name | 2-[[1-(3-chlorophenyl)cyclopropyl]methyl]-3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine |
|---|---|
| PubChem CID | 109457096 |
| Molecular Formula | C21H29ClN4OS |
| Molecular Weight | 421.01 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 2-[[1-(3-chlorophenyl)cyclopropyl]methyl]-3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine |
| SMILES | CCN/C(=N\CC1(c2cccc(Cl)c2)CC1)N(C)Cc1csc(C(C)OC)n1 |
| InChI | InChI=1S/C21H29ClN4OS/c1-5-23-20(26(3)12-18-13-28-19(25-18)15(2)27-4)24-14-21(9-10-21)16-7-6-8-17(22)11-16/h6-8,11,13,15H,5,9-10,12,14H2,1-4H3,(H,23,24) |
| InChIKey | CMXZDTLRWSADNR-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.01 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|