C17H24ClIN4OS — CID 109455035
3-[(3-chlorophenyl)methyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 109455035) has the molecular formula C17H24ClIN4OS and a molecular weight of 494.83 g/mol. Its IUPAC name is 3-[(3-chlorophenyl)methyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 3-[(3-chlorophenyl)methyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109455035 |
| Molecular Formula | C17H24ClIN4OS |
| Molecular Weight | 494.83 g/mol |
| Exact Mass | 494.04 |
| IUPAC Name | 3-[(3-chlorophenyl)methyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(Cl)c1)N(C)Cc1csc(C(C)OC)n1.I |
| InChI | InChI=1S/C17H23ClN4OS.HI/c1-12(23-4)16-21-15(11-24-16)10-22(3)17(19-2)20-9-13-6-5-7-14(18)8-13;/h5-8,11-12H,9-10H2,1-4H3,(H,19,20);1H |
| InChIKey | NCWWTTDDCRQPQZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.83 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|