C18H26BrIN4O2S — CID 109455025
3-[(3-bromo-4-methoxyphenyl)methyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 109455025) has the molecular formula C18H26BrIN4O2S and a molecular weight of 569.31 g/mol. Its IUPAC name is 3-[(3-bromo-4-methoxyphenyl)methyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 3-[(3-bromo-4-methoxyphenyl)methyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109455025 |
| Molecular Formula | C18H26BrIN4O2S |
| Molecular Weight | 569.31 g/mol |
| Exact Mass | 568.00 |
| IUPAC Name | 3-[(3-bromo-4-methoxyphenyl)methyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(OC)c(Br)c1)N(C)Cc1csc(C(C)OC)n1.I |
| InChI | InChI=1S/C18H25BrN4O2S.HI/c1-12(24-4)17-22-14(11-26-17)10-23(3)18(20-2)21-9-13-6-7-16(25-5)15(19)8-13;/h6-8,11-12H,9-10H2,1-5H3,(H,20,21);1H |
| InChIKey | VAKXPRUHJLGODZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 58.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.31 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|