C20H26N6OS — CID 109454528
1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[(3-pyrazol-1-ylphenyl)methyl]guanidine (PubChem CID 109454528) has the molecular formula C20H26N6OS and a molecular weight of 398.54 g/mol. Its IUPAC name is 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[(3-pyrazol-1-ylphenyl)methyl]guanidine.
| Compound Name | 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[(3-pyrazol-1-ylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 109454528 |
| Molecular Formula | C20H26N6OS |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[(3-pyrazol-1-ylphenyl)methyl]guanidine |
| SMILES | C/N=C(/NCc1cccc(-n2cccn2)c1)N(C)Cc1csc(C(C)OC)n1 |
| InChI | InChI=1S/C20H26N6OS/c1-15(27-4)19-24-17(14-28-19)13-25(3)20(21-2)22-12-16-7-5-8-18(11-16)26-10-6-9-23-26/h5-11,14-15H,12-13H2,1-4H3,(H,21,22) |
| InChIKey | RRVBAJZRTHTVGC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|