C22H29N5OS2 — CID 109455970
1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[[2-(2-phenylethyl)-1,3-thiazol-4-yl]methyl]guanidine (PubChem CID 109455970) has the molecular formula C22H29N5OS2 and a molecular weight of 443.64 g/mol. Its IUPAC name is 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[[2-(2-phenylethyl)-1,3-thiazol-4-yl]methyl]guanidine.
| Compound Name | 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[[2-(2-phenylethyl)-1,3-thiazol-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 109455970 |
| Molecular Formula | C22H29N5OS2 |
| Molecular Weight | 443.64 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[[2-(2-phenylethyl)-1,3-thiazol-4-yl]methyl]guanidine |
| SMILES | C/N=C(/NCc1csc(CCc2ccccc2)n1)N(C)Cc1csc(C(C)OC)n1 |
| InChI | InChI=1S/C22H29N5OS2/c1-16(28-4)21-26-19(15-30-21)13-27(3)22(23-2)24-12-18-14-29-20(25-18)11-10-17-8-6-5-7-9-17/h5-9,14-16H,10-13H2,1-4H3,(H,23,24) |
| InChIKey | MJNSNZLICJCFEK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.64 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|