C23H36N6OS — CID 109456734
3-[2-(4-benzylpiperazin-1-yl)ethyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine (PubChem CID 109456734) has the molecular formula C23H36N6OS and a molecular weight of 444.65 g/mol. Its IUPAC name is 3-[2-(4-benzylpiperazin-1-yl)ethyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine.
| Compound Name | 3-[2-(4-benzylpiperazin-1-yl)ethyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 109456734 |
| Molecular Formula | C23H36N6OS |
| Molecular Weight | 444.65 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | 3-[2-(4-benzylpiperazin-1-yl)ethyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine |
| SMILES | C/N=C(/NCCN1CCN(Cc2ccccc2)CC1)N(C)Cc1csc(C(C)OC)n1 |
| InChI | InChI=1S/C23H36N6OS/c1-19(30-4)22-26-21(18-31-22)17-27(3)23(24-2)25-10-11-28-12-14-29(15-13-28)16-20-8-6-5-7-9-20/h5-9,18-19H,10-17H2,1-4H3,(H,24,25) |
| InChIKey | MLDBGFDFPBZQCH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.65 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|