C19H28N4O2S2 — CID 109456358
3-(2-benzylsulfinylethyl)-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine (PubChem CID 109456358) has the molecular formula C19H28N4O2S2 and a molecular weight of 408.59 g/mol. Its IUPAC name is 3-(2-benzylsulfinylethyl)-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine.
| Compound Name | 3-(2-benzylsulfinylethyl)-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 109456358 |
| Molecular Formula | C19H28N4O2S2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 3-(2-benzylsulfinylethyl)-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine |
| SMILES | C/N=C(/NCCS(=O)Cc1ccccc1)N(C)Cc1csc(C(C)OC)n1 |
| InChI | InChI=1S/C19H28N4O2S2/c1-15(25-4)18-22-17(13-26-18)12-23(3)19(20-2)21-10-11-27(24)14-16-8-6-5-7-9-16/h5-9,13,15H,10-12,14H2,1-4H3,(H,20,21) |
| InChIKey | QIZMWMKVHQBNTJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|