C18H25FN4O3S2 — CID 109454538
3-[2-(2-fluorophenyl)sulfonylethyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine (PubChem CID 109454538) has the molecular formula C18H25FN4O3S2 and a molecular weight of 428.56 g/mol. Its IUPAC name is 3-[2-(2-fluorophenyl)sulfonylethyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine.
| Compound Name | 3-[2-(2-fluorophenyl)sulfonylethyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 109454538 |
| Molecular Formula | C18H25FN4O3S2 |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 3-[2-(2-fluorophenyl)sulfonylethyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine |
| SMILES | C/N=C(/NCCS(=O)(=O)c1ccccc1F)N(C)Cc1csc(C(C)OC)n1 |
| InChI | InChI=1S/C18H25FN4O3S2/c1-13(26-4)17-22-14(12-27-17)11-23(3)18(20-2)21-9-10-28(24,25)16-8-6-5-7-15(16)19/h5-8,12-13H,9-11H2,1-4H3,(H,20,21) |
| InChIKey | HRSWALLJSRIXQY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|