C18H26N6O3S — CID 109456410
1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[2-(4-nitroanilino)ethyl]guanidine (PubChem CID 109456410) has the molecular formula C18H26N6O3S and a molecular weight of 406.51 g/mol. Its IUPAC name is 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[2-(4-nitroanilino)ethyl]guanidine.
| Compound Name | 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[2-(4-nitroanilino)ethyl]guanidine |
|---|---|
| PubChem CID | 109456410 |
| Molecular Formula | C18H26N6O3S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[2-(4-nitroanilino)ethyl]guanidine |
| SMILES | C/N=C(/NCCNc1ccc([N+](=O)[O-])cc1)N(C)Cc1csc(C(C)OC)n1 |
| InChI | InChI=1S/C18H26N6O3S/c1-13(27-4)17-22-15(12-28-17)11-23(3)18(19-2)21-10-9-20-14-5-7-16(8-6-14)24(25)26/h5-8,12-13,20H,9-11H2,1-4H3,(H,19,21) |
| InChIKey | ZSLFARNHCBDAAW-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|