C15H23N7O3S — CID 109456312
1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[2-(4-nitropyrazol-1-yl)ethyl]guanidine (PubChem CID 109456312) has the molecular formula C15H23N7O3S and a molecular weight of 381.46 g/mol. Its IUPAC name is 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[2-(4-nitropyrazol-1-yl)ethyl]guanidine.
| Compound Name | 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[2-(4-nitropyrazol-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 109456312 |
| Molecular Formula | C15H23N7O3S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[2-(4-nitropyrazol-1-yl)ethyl]guanidine |
| SMILES | C/N=C(\NCCn1cc([N+](=O)[O-])cn1)N(C)Cc1csc(C(C)OC)n1 |
| InChI | InChI=1S/C15H23N7O3S/c1-11(25-4)14-19-12(10-26-14)8-20(3)15(16-2)17-5-6-21-9-13(7-18-21)22(23)24/h7,9-11H,5-6,8H2,1-4H3,(H,16,17) |
| InChIKey | GIPNXSLMFVLXHU-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 110.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|