C13H19N7O2S — CID 109423858
1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-[2-(4-nitropyrazol-1-yl)ethyl]guanidine (PubChem CID 109423858) has the molecular formula C13H19N7O2S and a molecular weight of 337.41 g/mol. Its IUPAC name is 1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-[2-(4-nitropyrazol-1-yl)ethyl]guanidine.
| Compound Name | 1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-[2-(4-nitropyrazol-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 109423858 |
| Molecular Formula | C13H19N7O2S |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-[2-(4-nitropyrazol-1-yl)ethyl]guanidine |
| SMILES | C/N=C(/NCCn1cc([N+](=O)[O-])cn1)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C13H19N7O2S/c1-10-17-11(9-23-10)7-18(3)13(14-2)15-4-5-19-8-12(6-16-19)20(21)22/h6,8-9H,4-5,7H2,1-3H3,(H,14,15) |
| InChIKey | KQUBIYFVBAASDR-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 101.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|