C12H17N5O3S — CID 111487593
1-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]-3-(4-nitropyrazol-1-yl)propan-2-ol (PubChem CID 111487593) has the molecular formula C12H17N5O3S and a molecular weight of 311.37 g/mol. Its IUPAC name is 1-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]-3-(4-nitropyrazol-1-yl)propan-2-ol.
| Compound Name | 1-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]-3-(4-nitropyrazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 111487593 |
| Molecular Formula | C12H17N5O3S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 1-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]-3-(4-nitropyrazol-1-yl)propan-2-ol |
| SMILES | Cc1nc(CN(C)CC(O)Cn2cc([N+](=O)[O-])cn2)cs1 |
| InChI | InChI=1S/C12H17N5O3S/c1-9-14-10(8-21-9)4-15(2)6-12(18)7-16-5-11(3-13-16)17(19)20/h3,5,8,12,18H,4,6-7H2,1-2H3 |
| InChIKey | BSSLAZBACDCQRX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 97.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|