C8H15N5O3 — CID 62141291
1-(2-aminoethylamino)-3-(4-nitropyrazol-1-yl)propan-2-ol (PubChem CID 62141291) has the molecular formula C8H15N5O3 and a molecular weight of 229.24 g/mol. Its IUPAC name is 1-(2-aminoethylamino)-3-(4-nitropyrazol-1-yl)propan-2-ol.
| Compound Name | 1-(2-aminoethylamino)-3-(4-nitropyrazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 62141291 |
| Molecular Formula | C8H15N5O3 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 1-(2-aminoethylamino)-3-(4-nitropyrazol-1-yl)propan-2-ol |
| SMILES | NCCNCC(O)Cn1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C8H15N5O3/c9-1-2-10-4-8(14)6-12-5-7(3-11-12)13(15)16/h3,5,8,10,14H,1-2,4,6,9H2 |
| InChIKey | BICFKCQKGNZYNI-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 119.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|