C13H24N4O4 — CID 115663099
1-(3-butoxypropylamino)-3-(4-nitropyrazol-1-yl)propan-2-ol (PubChem CID 115663099) has the molecular formula C13H24N4O4 and a molecular weight of 300.36 g/mol. Its IUPAC name is 1-(3-butoxypropylamino)-3-(4-nitropyrazol-1-yl)propan-2-ol.
| Compound Name | 1-(3-butoxypropylamino)-3-(4-nitropyrazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 115663099 |
| Molecular Formula | C13H24N4O4 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 1-(3-butoxypropylamino)-3-(4-nitropyrazol-1-yl)propan-2-ol |
| SMILES | CCCCOCCCNCC(O)Cn1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C13H24N4O4/c1-2-3-6-21-7-4-5-14-9-13(18)11-16-10-12(8-15-16)17(19)20/h8,10,13-14,18H,2-7,9,11H2,1H3 |
| InChIKey | ZUCZXVWXTBMDHE-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 102.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|