C12H22N4O4 — CID 103911913
3-[[2-hydroxy-3-(4-nitropyrazol-1-yl)propyl]amino]-2,3-dimethylbutan-2-ol (PubChem CID 103911913) has the molecular formula C12H22N4O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is 3-[[2-hydroxy-3-(4-nitropyrazol-1-yl)propyl]amino]-2,3-dimethylbutan-2-ol.
| Compound Name | 3-[[2-hydroxy-3-(4-nitropyrazol-1-yl)propyl]amino]-2,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 103911913 |
| Molecular Formula | C12H22N4O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 3-[[2-hydroxy-3-(4-nitropyrazol-1-yl)propyl]amino]-2,3-dimethylbutan-2-ol |
| SMILES | CC(C)(O)C(C)(C)NCC(O)Cn1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C12H22N4O4/c1-11(2,12(3,4)18)13-6-10(17)8-15-7-9(5-14-15)16(19)20/h5,7,10,13,17-18H,6,8H2,1-4H3 |
| InChIKey | PJBYVNABDHWBPY-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|