C11H21N5O3 — CID 82938606
1-[1-(dimethylamino)propan-2-ylamino]-3-(4-nitropyrazol-1-yl)propan-2-ol (PubChem CID 82938606) has the molecular formula C11H21N5O3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 1-[1-(dimethylamino)propan-2-ylamino]-3-(4-nitropyrazol-1-yl)propan-2-ol.
| Compound Name | 1-[1-(dimethylamino)propan-2-ylamino]-3-(4-nitropyrazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 82938606 |
| Molecular Formula | C11H21N5O3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 1-[1-(dimethylamino)propan-2-ylamino]-3-(4-nitropyrazol-1-yl)propan-2-ol |
| SMILES | CC(CN(C)C)NCC(O)Cn1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C11H21N5O3/c1-9(6-14(2)3)12-5-11(17)8-15-7-10(4-13-15)16(18)19/h4,7,9,11-12,17H,5-6,8H2,1-3H3 |
| InChIKey | IAHNYXZGBHSHDT-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 96.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|