C11H20N4O4 — CID 64604238
1-(4-methoxybutan-2-ylamino)-3-(4-nitropyrazol-1-yl)propan-2-ol (PubChem CID 64604238) has the molecular formula C11H20N4O4 and a molecular weight of 272.31 g/mol. Its IUPAC name is 1-(4-methoxybutan-2-ylamino)-3-(4-nitropyrazol-1-yl)propan-2-ol.
| Compound Name | 1-(4-methoxybutan-2-ylamino)-3-(4-nitropyrazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 64604238 |
| Molecular Formula | C11H20N4O4 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 1-(4-methoxybutan-2-ylamino)-3-(4-nitropyrazol-1-yl)propan-2-ol |
| SMILES | COCCC(C)NCC(O)Cn1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C11H20N4O4/c1-9(3-4-19-2)12-6-11(16)8-14-7-10(5-13-14)15(17)18/h5,7,9,11-12,16H,3-4,6,8H2,1-2H3 |
| InChIKey | KXRCQPWAVZYESN-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 102.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|