C12H23N5O4 — CID 62845026
1-[2-[2-methoxyethyl(methyl)amino]ethylamino]-3-(4-nitropyrazol-1-yl)propan-2-ol (PubChem CID 62845026) has the molecular formula C12H23N5O4 and a molecular weight of 301.35 g/mol. Its IUPAC name is 1-[2-[2-methoxyethyl(methyl)amino]ethylamino]-3-(4-nitropyrazol-1-yl)propan-2-ol.
| Compound Name | 1-[2-[2-methoxyethyl(methyl)amino]ethylamino]-3-(4-nitropyrazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 62845026 |
| Molecular Formula | C12H23N5O4 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 1-[2-[2-methoxyethyl(methyl)amino]ethylamino]-3-(4-nitropyrazol-1-yl)propan-2-ol |
| SMILES | COCCN(C)CCNCC(O)Cn1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C12H23N5O4/c1-15(5-6-21-2)4-3-13-8-12(18)10-16-9-11(7-14-16)17(19)20/h7,9,12-13,18H,3-6,8,10H2,1-2H3 |
| InChIKey | UKTAXQUYZJESEN-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|