C9H13F3N4O3 — CID 63226237
1-(4-nitropyrazol-1-yl)-3-(3,3,3-trifluoropropylamino)propan-2-ol (PubChem CID 63226237) has the molecular formula C9H13F3N4O3 and a molecular weight of 282.22 g/mol. Its IUPAC name is 1-(4-nitropyrazol-1-yl)-3-(3,3,3-trifluoropropylamino)propan-2-ol.
| Compound Name | 1-(4-nitropyrazol-1-yl)-3-(3,3,3-trifluoropropylamino)propan-2-ol |
|---|---|
| PubChem CID | 63226237 |
| Molecular Formula | C9H13F3N4O3 |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 1-(4-nitropyrazol-1-yl)-3-(3,3,3-trifluoropropylamino)propan-2-ol |
| SMILES | O=[N+]([O-])c1cnn(CC(O)CNCCC(F)(F)F)c1 |
| InChI | InChI=1S/C9H13F3N4O3/c10-9(11,12)1-2-13-4-8(17)6-15-5-7(3-14-15)16(18)19/h3,5,8,13,17H,1-2,4,6H2 |
| InChIKey | GKDHQIWRNGDWBY-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 93.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|