C12H19N7S — CID 109425058
1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine (PubChem CID 109425058) has the molecular formula C12H19N7S and a molecular weight of 293.40 g/mol. Its IUPAC name is 1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine.
| Compound Name | 1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109425058 |
| Molecular Formula | C12H19N7S |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
| SMILES | C/N=C(/NCc1nncn1C)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C12H19N7S/c1-9-16-10(7-20-9)6-18(3)12(13-2)14-5-11-17-15-8-19(11)4/h7-8H,5-6H2,1-4H3,(H,13,14) |
| InChIKey | HAOGMAKJGSPWOY-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 71.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|