C14H22IN5S2 — CID 109421449
3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 109421449) has the molecular formula C14H22IN5S2 and a molecular weight of 451.40 g/mol. Its IUPAC name is 3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109421449 |
| Molecular Formula | C14H22IN5S2 |
| Molecular Weight | 451.40 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | 3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1nc(C)c(C)s1)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C14H21N5S2.HI/c1-9-10(2)21-13(17-9)6-16-14(15-4)19(5)7-12-8-20-11(3)18-12;/h8H,6-7H2,1-5H3,(H,15,16);1H |
| InChIKey | HEDHPVVDUNGHPT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 53.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|