C18H22IN5S2 — CID 109421515
1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-[(4-phenyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide (PubChem CID 109421515) has the molecular formula C18H22IN5S2 and a molecular weight of 499.45 g/mol. Its IUPAC name is 1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-[(4-phenyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-[(4-phenyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109421515 |
| Molecular Formula | C18H22IN5S2 |
| Molecular Weight | 499.45 g/mol |
| Exact Mass | 499.04 |
| IUPAC Name | 1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-[(4-phenyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1nc(-c2ccccc2)cs1)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C18H21N5S2.HI/c1-13-21-15(11-24-13)10-23(3)18(19-2)20-9-17-22-16(12-25-17)14-7-5-4-6-8-14;/h4-8,11-12H,9-10H2,1-3H3,(H,19,20);1H |
| InChIKey | DNCABXDLIIFQFV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 53.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|