C18H24N4S — CID 109421476
1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-[(2-phenylcyclopropyl)methyl]guanidine (PubChem CID 109421476) has the molecular formula C18H24N4S and a molecular weight of 328.49 g/mol. Its IUPAC name is 1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-[(2-phenylcyclopropyl)methyl]guanidine.
| Compound Name | 1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-[(2-phenylcyclopropyl)methyl]guanidine |
|---|---|
| PubChem CID | 109421476 |
| Molecular Formula | C18H24N4S |
| Molecular Weight | 328.49 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-[(2-phenylcyclopropyl)methyl]guanidine |
| SMILES | C/N=C(/NCC1CC1c1ccccc1)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C18H24N4S/c1-13-21-16(12-23-13)11-22(3)18(19-2)20-10-15-9-17(15)14-7-5-4-6-8-14/h4-8,12,15,17H,9-11H2,1-3H3,(H,19,20) |
| InChIKey | BRHLZTWEBUKWRX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|