C17H22N6S — CID 109423450
1,2-dimethyl-3-[(1-methylbenzimidazol-2-yl)methyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine (PubChem CID 109423450) has the molecular formula C17H22N6S and a molecular weight of 342.47 g/mol. Its IUPAC name is 1,2-dimethyl-3-[(1-methylbenzimidazol-2-yl)methyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine.
| Compound Name | 1,2-dimethyl-3-[(1-methylbenzimidazol-2-yl)methyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109423450 |
| Molecular Formula | C17H22N6S |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 1,2-dimethyl-3-[(1-methylbenzimidazol-2-yl)methyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
| SMILES | C/N=C(/NCc1nc2ccccc2n1C)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C17H22N6S/c1-12-20-13(11-24-12)10-22(3)17(18-2)19-9-16-21-14-7-5-6-8-15(14)23(16)4/h5-8,11H,9-10H2,1-4H3,(H,18,19) |
| InChIKey | MIAHSFVWSHAMHL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|