C19H28FIN4O2S — CID 109456765
3-[3-(4-fluorophenoxy)propyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 109456765) has the molecular formula C19H28FIN4O2S and a molecular weight of 522.43 g/mol. Its IUPAC name is 3-[3-(4-fluorophenoxy)propyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 3-[3-(4-fluorophenoxy)propyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109456765 |
| Molecular Formula | C19H28FIN4O2S |
| Molecular Weight | 522.43 g/mol |
| Exact Mass | 522.10 |
| IUPAC Name | 3-[3-(4-fluorophenoxy)propyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCCOc1ccc(F)cc1)N(C)Cc1csc(C(C)OC)n1.I |
| InChI | InChI=1S/C19H27FN4O2S.HI/c1-14(25-4)18-23-16(13-27-18)12-24(3)19(21-2)22-10-5-11-26-17-8-6-15(20)7-9-17;/h6-9,13-14H,5,10-12H2,1-4H3,(H,21,22);1H |
| InChIKey | CRBAHUJSHMNOTO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 58.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|