C14H26N4O2S — CID 109456082
1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-3-(3-methoxypropyl)-1,2-dimethylguanidine (PubChem CID 109456082) has the molecular formula C14H26N4O2S and a molecular weight of 314.46 g/mol. Its IUPAC name is 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-3-(3-methoxypropyl)-1,2-dimethylguanidine.
| Compound Name | 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-3-(3-methoxypropyl)-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 109456082 |
| Molecular Formula | C14H26N4O2S |
| Molecular Weight | 314.46 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-3-(3-methoxypropyl)-1,2-dimethylguanidine |
| SMILES | C/N=C(\NCCCOC)N(C)Cc1csc(C(C)OC)n1 |
| InChI | InChI=1S/C14H26N4O2S/c1-11(20-5)13-17-12(10-21-13)9-18(3)14(15-2)16-7-6-8-19-4/h10-11H,6-9H2,1-5H3,(H,15,16) |
| InChIKey | NBJGPQSMXVFAJX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 58.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.46 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|