C20H29ClIN5O2S — CID 109454571
N-(4-chlorophenyl)-4-[[N-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-N,N'-dimethylcarbamimidoyl]amino]butanamide;hydroiodide (PubChem CID 109454571) has the molecular formula C20H29ClIN5O2S and a molecular weight of 565.91 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[[N-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-N,N'-dimethylcarbamimidoyl]amino]butanamide;hydroiodide.
| Compound Name | N-(4-chlorophenyl)-4-[[N-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-N,N'-dimethylcarbamimidoyl]amino]butanamide;hydroiodide |
|---|---|
| PubChem CID | 109454571 |
| Molecular Formula | C20H29ClIN5O2S |
| Molecular Weight | 565.91 g/mol |
| Exact Mass | 565.08 |
| IUPAC Name | N-(4-chlorophenyl)-4-[[N-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-N,N'-dimethylcarbamimidoyl]amino]butanamide;hydroiodide |
| SMILES | C/N=C(/NCCCC(=O)Nc1ccc(Cl)cc1)N(C)Cc1csc(C(C)OC)n1.I |
| InChI | InChI=1S/C20H28ClN5O2S.HI/c1-14(28-4)19-25-17(13-29-19)12-26(3)20(22-2)23-11-5-6-18(27)24-16-9-7-15(21)8-10-16;/h7-10,13-14H,5-6,11-12H2,1-4H3,(H,22,23)(H,24,27);1H |
| InChIKey | PPQLRTLMUTXMEC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.91 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|