C20H29ClN4OS — CID 109454968
3-[2-(4-chlorophenyl)-2-methylpropyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine (PubChem CID 109454968) has the molecular formula C20H29ClN4OS and a molecular weight of 409.00 g/mol. Its IUPAC name is 3-[2-(4-chlorophenyl)-2-methylpropyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine.
| Compound Name | 3-[2-(4-chlorophenyl)-2-methylpropyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 109454968 |
| Molecular Formula | C20H29ClN4OS |
| Molecular Weight | 409.00 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 3-[2-(4-chlorophenyl)-2-methylpropyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine |
| SMILES | C/N=C(/NCC(C)(C)c1ccc(Cl)cc1)N(C)Cc1csc(C(C)OC)n1 |
| InChI | InChI=1S/C20H29ClN4OS/c1-14(26-6)18-24-17(12-27-18)11-25(5)19(22-4)23-13-20(2,3)15-7-9-16(21)10-8-15/h7-10,12,14H,11,13H2,1-6H3,(H,22,23) |
| InChIKey | BKCDUWVHVBXEKO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.00 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|