C19H24ClIN6O2S — CID 109456949
3-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 109456949) has the molecular formula C19H24ClIN6O2S and a molecular weight of 562.87 g/mol. Its IUPAC name is 3-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 3-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109456949 |
| Molecular Formula | C19H24ClIN6O2S |
| Molecular Weight | 562.87 g/mol |
| Exact Mass | 562.04 |
| IUPAC Name | 3-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1nc(-c2ccc(Cl)cc2)no1)N(C)Cc1csc(C(C)OC)n1.I |
| InChI | InChI=1S/C19H23ClN6O2S.HI/c1-12(27-4)18-23-15(11-29-18)10-26(3)19(21-2)22-9-16-24-17(25-28-16)13-5-7-14(20)8-6-13;/h5-8,11-12H,9-10H2,1-4H3,(H,21,22);1H |
| InChIKey | JDLCSZBTQPHUFI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 88.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.87 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|