C20H28IN7O2S — CID 109456039
1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-3-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 109456039) has the molecular formula C20H28IN7O2S and a molecular weight of 557.46 g/mol. Its IUPAC name is 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-3-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-3-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109456039 |
| Molecular Formula | C20H28IN7O2S |
| Molecular Weight | 557.46 g/mol |
| Exact Mass | 557.11 |
| IUPAC Name | 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-3-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1nc(-c2ccc(OC)cc2)n[nH]1)N(C)Cc1csc(C(C)OC)n1.I |
| InChI | InChI=1S/C20H27N7O2S.HI/c1-13(28-4)19-23-15(12-30-19)11-27(3)20(21-2)22-10-17-24-18(26-25-17)14-6-8-16(29-5)9-7-14;/h6-9,12-13H,10-11H2,1-5H3,(H,21,22)(H,24,25,26);1H |
| InChIKey | FXLYFGMHGLAENA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|